C10H19NSi2+2 — CID 163852968
2,5-dimethyl-1-phenyl-1-aza-2,5-disilanyliacyclopentane (PubChem CID 163852968) has the molecular formula C10H19NSi2+2 and a molecular weight of 209.44 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-1-aza-2,5-disilanyliacyclopentane.
| Compound Name | 2,5-dimethyl-1-phenyl-1-aza-2,5-disilanyliacyclopentane |
|---|---|
| PubChem CID | 163852968 |
| Molecular Formula | C10H19NSi2+2 |
| Molecular Weight | 209.44 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-1-aza-2,5-disilanyliacyclopentane |
| SMILES | C[SiH2+]1CC[SiH2+](C)N1c1ccccc1 |
| InChI | InChI=1S/C10H19NSi2/c1-12-8-9-13(2)11(12)10-6-4-3-5-7-10/h3-7H,8-9,12-13H2,1-2H3/q+2 |
| InChIKey | DJMMQFWRUDLYNG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|