C11H16N2 — CID 163883953
2-[3-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-yl]ethanimidamide (PubChem CID 163883953) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[3-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-yl]ethanimidamide.
| Compound Name | 2-[3-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 163883953 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-[3-[(Z)-prop-1-enyl]cyclohexa-2,4-dien-1-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CC1C=C(/C=C\C)C=CC1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-9-5-3-6-10(7-9)8-11(12)13/h2-5,7,10H,6,8H2,1H3,(H3,12,13)/b4-2- |
| InChIKey | PVRZUUKQXRDBGQ-RQOWECAXSA-N |
| XLogP | 2.39 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|