C7H8INO6 — CID 163896779
4-[iodo-[(2-oxo-1,3-dioxolan-4-yl)amino]methyl]-1,3-dioxolan-2-one (PubChem CID 163896779) has the molecular formula C7H8INO6 and a molecular weight of 329.05 g/mol. Its IUPAC name is 4-[iodo-[(2-oxo-1,3-dioxolan-4-yl)amino]methyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[iodo-[(2-oxo-1,3-dioxolan-4-yl)amino]methyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 163896779 |
| Molecular Formula | C7H8INO6 |
| Molecular Weight | 329.05 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | 4-[iodo-[(2-oxo-1,3-dioxolan-4-yl)amino]methyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(NC(I)C2COC(=O)O2)O1 |
| InChI | InChI=1S/C7H8INO6/c8-5(3-1-12-6(10)14-3)9-4-2-13-7(11)15-4/h3-5,9H,1-2H2 |
| InChIKey | QGIHFLLPNAHTCI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.05 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|