C21H16BrFN4O3 — CID 163903304
5-bromo-2-[6-(4-fluorophenoxy)-3-pyridinyl]-6-hydrazinyl-N-methyl-1-benzofuran-3-carboxamide (PubChem CID 163903304) has the molecular formula C21H16BrFN4O3 and a molecular weight of 471.29 g/mol. Its IUPAC name is 5-bromo-2-[6-(4-fluorophenoxy)-3-pyridinyl]-6-hydrazinyl-N-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 5-bromo-2-[6-(4-fluorophenoxy)-3-pyridinyl]-6-hydrazinyl-N-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 163903304 |
| Molecular Formula | C21H16BrFN4O3 |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 5-bromo-2-[6-(4-fluorophenoxy)-3-pyridinyl]-6-hydrazinyl-N-methyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(Oc3ccc(F)cc3)nc2)oc2cc(NN)c(Br)cc12 |
| InChI | InChI=1S/C21H16BrFN4O3/c1-25-21(28)19-14-8-15(22)16(27-24)9-17(14)30-20(19)11-2-7-18(26-10-11)29-13-5-3-12(23)4-6-13/h2-10,27H,24H2,1H3,(H,25,28) |
| InChIKey | SUUQEQHDPAAYHG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|