C12H18O6S2 — CID 163913543
4-[2-[2-[2-(2-oxo-1,3-dioxolan-4-yl)ethylsulfanyl]ethylsulfanyl]ethyl]-1,3-dioxolan-2-one (PubChem CID 163913543) has the molecular formula C12H18O6S2 and a molecular weight of 322.40 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-oxo-1,3-dioxolan-4-yl)ethylsulfanyl]ethylsulfanyl]ethyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[2-[2-[2-(2-oxo-1,3-dioxolan-4-yl)ethylsulfanyl]ethylsulfanyl]ethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 163913543 |
| Molecular Formula | C12H18O6S2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-[2-[2-[2-(2-oxo-1,3-dioxolan-4-yl)ethylsulfanyl]ethylsulfanyl]ethyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CCSCCSCCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C12H18O6S2/c13-11-15-7-9(17-11)1-3-19-5-6-20-4-2-10-8-16-12(14)18-10/h9-10H,1-8H2 |
| InChIKey | MPQJGMRRHMZLKC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|