C10H19NO3 — CID 163925615
(6-amino-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-3-yl)methanol (PubChem CID 163925615) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (6-amino-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-3-yl)methanol.
| Compound Name | (6-amino-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-3-yl)methanol |
|---|---|
| PubChem CID | 163925615 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (6-amino-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-benzo[b][1,4]dioxin-3-yl)methanol |
| SMILES | CC1(N)CCC2OCC(CO)OC2C1 |
| InChI | InChI=1S/C10H19NO3/c1-10(11)3-2-8-9(4-10)14-7(5-12)6-13-8/h7-9,12H,2-6,11H2,1H3 |
| InChIKey | REFCYMRDTGGMRK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |