C22H32O5 — CID 163927008
[6-formyl-6-(2-tricyclo[3.3.1.03,7]nonanyloxymethoxymethyl)-2-bicyclo[2.2.1]heptanyl] propanoate (PubChem CID 163927008) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [6-formyl-6-(2-tricyclo[3.3.1.03,7]nonanyloxymethoxymethyl)-2-bicyclo[2.2.1]heptanyl] propanoate.
| Compound Name | [6-formyl-6-(2-tricyclo[3.3.1.03,7]nonanyloxymethoxymethyl)-2-bicyclo[2.2.1]heptanyl] propanoate |
|---|---|
| PubChem CID | 163927008 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [6-formyl-6-(2-tricyclo[3.3.1.03,7]nonanyloxymethoxymethyl)-2-bicyclo[2.2.1]heptanyl] propanoate |
| SMILES | CCC(=O)OC1CC2CC1C(C=O)(COCOC1C3CC4CC(C3)C1C4)C2 |
| InChI | InChI=1S/C22H32O5/c1-2-20(24)27-19-7-14-6-18(19)22(9-14,10-23)11-25-12-26-21-16-4-13-3-15(8-16)17(21)5-13/h10,13-19,21H,2-9,11-12H2,1H3 |
| InChIKey | RFJFUYZKCNHYQZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|