C6H12N2O — CID 163932008
4,7-dimethyl-1-oxa-4,7-diazaspiro[2.4]heptane (PubChem CID 163932008) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 4,7-dimethyl-1-oxa-4,7-diazaspiro[2.4]heptane.
| Compound Name | 4,7-dimethyl-1-oxa-4,7-diazaspiro[2.4]heptane |
|---|---|
| PubChem CID | 163932008 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 4,7-dimethyl-1-oxa-4,7-diazaspiro[2.4]heptane |
| SMILES | CN1CCN(C)C12CO2 |
| InChI | InChI=1S/C6H12N2O/c1-7-3-4-8(2)6(7)5-9-6/h3-5H2,1-2H3 |
| InChIKey | RJLQOVKFEREXIY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 19.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|