C12H12N2O2 — CID 163932150
(7R)-spiro[1,5,6,8-tetrahydrocycloocta[b]pyrrole-7,2'-1-azabicyclo[1.1.0]butane]-4,9-dione (PubChem CID 163932150) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (7R)-spiro[1,5,6,8-tetrahydrocycloocta[b]pyrrole-7,2'-1-azabicyclo[1.1.0]butane]-4,9-dione.
| Compound Name | (7R)-spiro[1,5,6,8-tetrahydrocycloocta[b]pyrrole-7,2'-1-azabicyclo[1.1.0]butane]-4,9-dione |
|---|---|
| PubChem CID | 163932150 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (7R)-spiro[1,5,6,8-tetrahydrocycloocta[b]pyrrole-7,2'-1-azabicyclo[1.1.0]butane]-4,9-dione |
| SMILES | O=C1CC[C@@]2(CC(=O)c3[nH]ccc31)C1CN12 |
| InChI | InChI=1S/C12H12N2O2/c15-8-1-3-12(10-6-14(10)12)5-9(16)11-7(8)2-4-13-11/h2,4,10,13H,1,3,5-6H2/t10?,12-,14?/m1/s1 |
| InChIKey | RJOWRHPGLBWXDF-KSGYAGIASA-N |
| XLogP | 1.00 |
| TPSA | 52.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|