C20H15N5O5S2 — CID 163932979
4-[(6-amino-5-hydroxy-7-hydroxysulfanylnaphthalen-2-yl)diazenyl]-5-oxo-1-(4-sulfanylphenyl)-4H-pyrazole-3-carboxylic acid (PubChem CID 163932979) has the molecular formula C20H15N5O5S2 and a molecular weight of 469.50 g/mol. Its IUPAC name is 4-[(6-amino-5-hydroxy-7-hydroxysulfanylnaphthalen-2-yl)diazenyl]-5-oxo-1-(4-sulfanylphenyl)-4H-pyrazole-3-carboxylic acid.
| Compound Name | 4-[(6-amino-5-hydroxy-7-hydroxysulfanylnaphthalen-2-yl)diazenyl]-5-oxo-1-(4-sulfanylphenyl)-4H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 163932979 |
| Molecular Formula | C20H15N5O5S2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 4-[(6-amino-5-hydroxy-7-hydroxysulfanylnaphthalen-2-yl)diazenyl]-5-oxo-1-(4-sulfanylphenyl)-4H-pyrazole-3-carboxylic acid |
| SMILES | Nc1c(SO)cc2cc(/N=N/C3C(=O)N(c4ccc(S)cc4)N=C3C(=O)O)ccc2c1O |
| InChI | InChI=1S/C20H15N5O5S2/c21-15-14(32-30)8-9-7-10(1-6-13(9)18(15)26)22-23-16-17(20(28)29)24-25(19(16)27)11-2-4-12(31)5-3-11/h1-8,16,26,30-31H,21H2,(H,28,29)/b23-22+ |
| InChIKey | RKGZJUQVZBOPDA-GHVJWSGMSA-N |
| XLogP | 3.92 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|