C18H19N2O2S- — CID 163937987
N-[2-[4-(2,2-dimethylpropyl)phenyl]-1,3-benzothiazol-6-yl]-N-oxidohydroxylamine (PubChem CID 163937987) has the molecular formula C18H19N2O2S- and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[2-[4-(2,2-dimethylpropyl)phenyl]-1,3-benzothiazol-6-yl]-N-oxidohydroxylamine.
| Compound Name | N-[2-[4-(2,2-dimethylpropyl)phenyl]-1,3-benzothiazol-6-yl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163937987 |
| Molecular Formula | C18H19N2O2S- |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[2-[4-(2,2-dimethylpropyl)phenyl]-1,3-benzothiazol-6-yl]-N-oxidohydroxylamine |
| SMILES | CC(C)(C)Cc1ccc(-c2nc3ccc(N([O-])O)cc3s2)cc1 |
| InChI | InChI=1S/C18H19N2O2S/c1-18(2,3)11-12-4-6-13(7-5-12)17-19-15-9-8-14(20(21)22)10-16(15)23-17/h4-10,21H,11H2,1-3H3/q-1 |
| InChIKey | ZEURTINPBABVRW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|