C7H9I2N — CID 163943367
N-iodo-6-methyl-1λ3-iodacyclohepta-2,4,7-trien-3-amine (PubChem CID 163943367) has the molecular formula C7H9I2N and a molecular weight of 360.96 g/mol. Its IUPAC name is N-iodo-6-methyl-1λ3-iodacyclohepta-2,4,7-trien-3-amine.
| Compound Name | N-iodo-6-methyl-1λ3-iodacyclohepta-2,4,7-trien-3-amine |
|---|---|
| PubChem CID | 163943367 |
| Molecular Formula | C7H9I2N |
| Molecular Weight | 360.96 g/mol |
| Exact Mass | 360.88 |
| IUPAC Name | N-iodo-6-methyl-1λ3-iodacyclohepta-2,4,7-trien-3-amine |
| SMILES | CC1C=CC(NI)=CI=C1 |
| InChI | InChI=1S/C7H9I2N/c1-6-2-3-7(10-8)5-9-4-6/h2-6,10H,1H3 |
| InChIKey | RSYYIZPWJJRCRW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.96 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|