C26H34N4O5S2 — CID 163949013
N-[2-(4-amino-3-methylphenyl)sulfonyl-3-(diethylamino)phenyl]acetamide;4-methylbenzenesulfonamide (PubChem CID 163949013) has the molecular formula C26H34N4O5S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is N-[2-(4-amino-3-methylphenyl)sulfonyl-3-(diethylamino)phenyl]acetamide;4-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-amino-3-methylphenyl)sulfonyl-3-(diethylamino)phenyl]acetamide;4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 163949013 |
| Molecular Formula | C26H34N4O5S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-[2-(4-amino-3-methylphenyl)sulfonyl-3-(diethylamino)phenyl]acetamide;4-methylbenzenesulfonamide |
| SMILES | CCN(CC)c1cccc(NC(C)=O)c1S(=O)(=O)c1ccc(N)c(C)c1.Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H25N3O3S.C7H9NO2S/c1-5-22(6-2)18-9-7-8-17(21-14(4)23)19(18)26(24,25)15-10-11-16(20)13(3)12-15;1-6-2-4-7(5-3-6)11(8,9)10/h7-12H,5-6,20H2,1-4H3,(H,21,23);2-5H,1H3,(H2,8,9,10) |
| InChIKey | RXQRWRNEVVPQOV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|