C8H18O2PU- — CID 163957438
5,5-dimethyl-1,3,2-dioxaphosphinane;propane;uranium (PubChem CID 163957438) has the molecular formula C8H18O2PU- and a molecular weight of 415.23 g/mol. Its IUPAC name is 5,5-dimethyl-1,3,2-dioxaphosphinane;propane;uranium.
| Compound Name | 5,5-dimethyl-1,3,2-dioxaphosphinane;propane;uranium |
|---|---|
| PubChem CID | 163957438 |
| Molecular Formula | C8H18O2PU- |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 5,5-dimethyl-1,3,2-dioxaphosphinane;propane;uranium |
| SMILES | CC1(C)COPOC1.C[CH-]C.[U] |
| InChI | InChI=1S/C5H11O2P.C3H7.U/c1-5(2)3-6-8-7-4-5;1-3-2;/h8H,3-4H2,1-2H3;3H,1-2H3;/q;-1; |
| InChIKey | DBNBFXAHXWCDFU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|