C5H13O2PY — CID 156748573
5,5-dimethyl-1,3,2-dioxaphosphinane;molecular hydrogen;yttrium (PubChem CID 156748573) has the molecular formula C5H13O2PY and a molecular weight of 225.04 g/mol. Its IUPAC name is 5,5-dimethyl-1,3,2-dioxaphosphinane;molecular hydrogen;yttrium.
| Compound Name | 5,5-dimethyl-1,3,2-dioxaphosphinane;molecular hydrogen;yttrium |
|---|---|
| PubChem CID | 156748573 |
| Molecular Formula | C5H13O2PY |
| Molecular Weight | 225.04 g/mol |
| Exact Mass | 224.97 |
| IUPAC Name | 5,5-dimethyl-1,3,2-dioxaphosphinane;molecular hydrogen;yttrium |
| SMILES | CC1(C)COPOC1.[H][H].[Y] |
| InChI | InChI=1S/C5H11O2P.Y.H2/c1-5(2)3-6-8-7-4-5;;/h8H,3-4H2,1-2H3;;1H |
| InChIKey | KPMSJCBYCNYBCX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.04 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|