C25H31N7O4 — CID 163966622
2-[amino-[(Z)-2-amino-3-methylbut-1-enyl]amino]-N-[4-[[5-hydroxy-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-yl]amino]phenyl]acetamide (PubChem CID 163966622) has the molecular formula C25H31N7O4 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-amino-3-methylbut-1-enyl]amino]-N-[4-[[5-hydroxy-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-[amino-[(Z)-2-amino-3-methylbut-1-enyl]amino]-N-[4-[[5-hydroxy-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 163966622 |
| Molecular Formula | C25H31N7O4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[amino-[(Z)-2-amino-3-methylbut-1-enyl]amino]-N-[4-[[5-hydroxy-7-[(3S)-oxolan-3-yl]oxyquinazolin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(C)/C(N)=C/N(N)CC(=O)Nc1ccc(Nc2ncnc3cc(O[C@H]4CCOC4)cc(O)c23)cc1 |
| InChI | InChI=1S/C25H31N7O4/c1-15(2)20(26)11-32(27)12-23(34)30-16-3-5-17(6-4-16)31-25-24-21(28-14-29-25)9-19(10-22(24)33)36-18-7-8-35-13-18/h3-6,9-11,14-15,18,33H,7-8,12-13,26-27H2,1-2H3,(H,30,34)(H,28,29,31)/b20-11-/t18-/m0/s1 |
| InChIKey | SMIVLJBZOCKHMW-ISRVBRPNSA-N |
| XLogP | 2.82 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|