C20H40O9 — CID 163973493
dodecanedioic acid;1-(2-ethoxyethoxy)-2-(2-hydroxyethoxy)ethanol (PubChem CID 163973493) has the molecular formula C20H40O9 and a molecular weight of 424.53 g/mol. Its IUPAC name is dodecanedioic acid;1-(2-ethoxyethoxy)-2-(2-hydroxyethoxy)ethanol.
| Compound Name | dodecanedioic acid;1-(2-ethoxyethoxy)-2-(2-hydroxyethoxy)ethanol |
|---|---|
| PubChem CID | 163973493 |
| Molecular Formula | C20H40O9 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | dodecanedioic acid;1-(2-ethoxyethoxy)-2-(2-hydroxyethoxy)ethanol |
| SMILES | CCOCCOC(O)COCCO.O=C(O)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H22O4.C8H18O5/c13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16;1-2-11-5-6-13-8(10)7-12-4-3-9/h1-10H2,(H,13,14)(H,15,16);8-10H,2-7H2,1H3 |
| InChIKey | SSBLYWRHBADTGL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|