C35H38O4 — CID 163975376
2-[3-[4-[(1R,2R)-2-cyclohexa-2,4-dien-1-yl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutyl]oxyethanol (PubChem CID 163975376) has the molecular formula C35H38O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-[3-[4-[(1R,2R)-2-cyclohexa-2,4-dien-1-yl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutyl]oxyethanol.
| Compound Name | 2-[3-[4-[(1R,2R)-2-cyclohexa-2,4-dien-1-yl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutyl]oxyethanol |
|---|---|
| PubChem CID | 163975376 |
| Molecular Formula | C35H38O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 2-[3-[4-[(1R,2R)-2-cyclohexa-2,4-dien-1-yl-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy]cyclobutyl]oxyethanol |
| SMILES | OCCOC1CC(Oc2ccc([C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@@H]3C3C=CC=CC3)cc2)C1 |
| InChI | InChI=1S/C35H38O4/c36-19-20-37-31-22-32(23-31)39-29-14-11-27(12-15-29)35-33(26-9-5-2-6-10-26)17-13-28-21-30(16-18-34(28)35)38-24-25-7-3-1-4-8-25/h1-9,11-12,14-16,18,21,26,31-33,35-36H,10,13,17,19-20,22-24H2/t26?,31?,32?,33-,35+/m1/s1 |
| InChIKey | STQGMMIDTFNWDI-HCYYIUGPSA-N |
| XLogP | 7.01 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |