C34H59N5O7 — CID 163993288
6-[2-[2-[3-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-2-oxobutoxy]ethoxy]ethylamino]-2,2,4,4,6-pentamethylheptanoic acid (PubChem CID 163993288) has the molecular formula C34H59N5O7 and a molecular weight of 649.87 g/mol. Its IUPAC name is 6-[2-[2-[3-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-2-oxobutoxy]ethoxy]ethylamino]-2,2,4,4,6-pentamethylheptanoic acid.
| Compound Name | 6-[2-[2-[3-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-2-oxobutoxy]ethoxy]ethylamino]-2,2,4,4,6-pentamethylheptanoic acid |
|---|---|
| PubChem CID | 163993288 |
| Molecular Formula | C34H59N5O7 |
| Molecular Weight | 649.87 g/mol |
| Exact Mass | 649.44 |
| IUPAC Name | 6-[2-[2-[3-[[1-amino-6-[(4-aminobenzoyl)amino]-1-oxohexan-2-yl]amino]-3-methyl-2-oxobutoxy]ethoxy]ethylamino]-2,2,4,4,6-pentamethylheptanoic acid |
| SMILES | CC(C)(CC(C)(C)NCCOCCOCC(=O)C(C)(C)NC(CCCCNC(=O)c1ccc(N)cc1)C(N)=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C34H59N5O7/c1-31(2,22-32(3,4)30(43)44)23-33(5,6)38-17-18-45-19-20-46-21-27(40)34(7,8)39-26(28(36)41)11-9-10-16-37-29(42)24-12-14-25(35)15-13-24/h12-15,26,38-39H,9-11,16-23,35H2,1-8H3,(H2,36,41)(H,37,42)(H,43,44) |
| InChIKey | UCMZIBWWPHUUTM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 195.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|