C25H49ClN4O8 — CID 163996261
(2S,5R)-5-(butoxyamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;(2S,5R)-5-(butoxyamino)piperidine-2-carboxylic acid;hydrochloride (PubChem CID 163996261) has the molecular formula C25H49ClN4O8 and a molecular weight of 569.14 g/mol. Its IUPAC name is (2S,5R)-5-(butoxyamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;(2S,5R)-5-(butoxyamino)piperidine-2-carboxylic acid;hydrochloride.
| Compound Name | (2S,5R)-5-(butoxyamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;(2S,5R)-5-(butoxyamino)piperidine-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 163996261 |
| Molecular Formula | C25H49ClN4O8 |
| Molecular Weight | 569.14 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | (2S,5R)-5-(butoxyamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid;(2S,5R)-5-(butoxyamino)piperidine-2-carboxylic acid;hydrochloride |
| SMILES | CCCCON[C@@H]1CC[C@@H](C(=O)O)N(C(=O)OC(C)(C)C)C1.CCCCON[C@@H]1CC[C@@H](C(=O)O)NC1.Cl |
| InChI | InChI=1S/C15H28N2O5.C10H20N2O3.ClH/c1-5-6-9-21-16-11-7-8-12(13(18)19)17(10-11)14(20)22-15(2,3)4;1-2-3-6-15-12-8-4-5-9(10(13)14)11-7-8;/h11-12,16H,5-10H2,1-4H3,(H,18,19);8-9,11-12H,2-7H2,1H3,(H,13,14);1H/t11-,12+;8-,9+;/m11./s1 |
| InChIKey | NBLCZCHHVRWNJQ-AQSDFRQFSA-N |
| XLogP | 3.10 |
| TPSA | 158.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|