C23H30ClFN8O — CID 164534486
7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrido[4,3-d]pyrimidine (PubChem CID 164534486) has the molecular formula C23H30ClFN8O and a molecular weight of 489.00 g/mol. Its IUPAC name is 7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 164534486 |
| Molecular Formula | C23H30ClFN8O |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[3-(3-methyl-2,3-dihydro-1H-1,2,4-triazol-5-yl)piperidin-1-yl]pyrido[4,3-d]pyrimidine |
| SMILES | CC1N=C(C2CCCN(c3nc(OCC45CCCN4CCC5)nc4c(F)c(Cl)ncc34)C2)NN1 |
| InChI | InChI=1S/C23H30ClFN8O/c1-14-27-20(31-30-14)15-5-2-8-32(12-15)21-16-11-26-19(24)17(25)18(16)28-22(29-21)34-13-23-6-3-9-33(23)10-4-7-23/h11,14-15,30H,2-10,12-13H2,1H3,(H,27,31) |
| InChIKey | IKOLTXRUGJJEJN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|