C19H23ClFN5OS — CID 164535147
7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-ylmethyl)pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 164535147) has the molecular formula C19H23ClFN5OS and a molecular weight of 423.95 g/mol. Its IUPAC name is 7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-ylmethyl)pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | 7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-ylmethyl)pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 164535147 |
| Molecular Formula | C19H23ClFN5OS |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 7-chloro-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-N-(thietan-3-ylmethyl)pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | Fc1c(Cl)ncc2c(NCC3CSC3)nc(OCC34CCCN3CCC4)nc12 |
| InChI | InChI=1S/C19H23ClFN5OS/c20-16-14(21)15-13(8-22-16)17(23-7-12-9-28-10-12)25-18(24-15)27-11-19-3-1-5-26(19)6-2-4-19/h8,12H,1-7,9-11H2,(H,23,24,25) |
| InChIKey | CAZIWYKVTZBYFX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|