C32H31F3N6O7S — CID 164537665
ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate (PubChem CID 164537665) has the molecular formula C32H31F3N6O7S and a molecular weight of 700.70 g/mol. Its IUPAC name is ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate.
| Compound Name | ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164537665 |
| Molecular Formula | C32H31F3N6O7S |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | ethyl (7R)-7-[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-2-[4-[3-(trifluoromethyl)phenoxy]phenyl]-4,5,6,7-tetrahydropyrazolo[4,3-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c2c(nn1-c1ccc(Oc3cccc(C(F)(F)F)c3)cc1)[C@H](N1CCN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CC1)CCN2 |
| InChI | InChI=1S/C32H31F3N6O7S/c1-2-47-31(42)30-29-28(37-40(30)22-10-12-23(13-11-22)48-24-7-5-6-21(20-24)32(33,34)35)26(14-15-36-29)38-16-18-39(19-17-38)49(45,46)27-9-4-3-8-25(27)41(43)44/h3-13,20,26,36H,2,14-19H2,1H3/t26-/m1/s1 |
| InChIKey | KOLKGXAOWYCLAQ-AREMUKBSSA-N |
| XLogP | 5.63 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.70 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|