C15H12N4O5S2 — CID 164565503
[4-(methyldisulfanyl)phenyl]methyl N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate (PubChem CID 164565503) has the molecular formula C15H12N4O5S2 and a molecular weight of 392.42 g/mol. Its IUPAC name is [4-(methyldisulfanyl)phenyl]methyl N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate.
| Compound Name | [4-(methyldisulfanyl)phenyl]methyl N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate |
|---|---|
| PubChem CID | 164565503 |
| Molecular Formula | C15H12N4O5S2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | [4-(methyldisulfanyl)phenyl]methyl N-(4-nitro-2,1,3-benzoxadiazol-7-yl)carbamate |
| SMILES | CSSc1ccc(COC(=O)Nc2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C15H12N4O5S2/c1-25-26-10-4-2-9(3-5-10)8-23-15(20)16-11-6-7-12(19(21)22)14-13(11)17-24-18-14/h2-7H,8H2,1H3,(H,16,20) |
| InChIKey | JHBGADHLIGCINE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|