C23H31N3OS — CID 164571839
ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;prop-1-ene (PubChem CID 164571839) has the molecular formula C23H31N3OS and a molecular weight of 397.59 g/mol. Its IUPAC name is ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;prop-1-ene.
| Compound Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 164571839 |
| Molecular Formula | C23H31N3OS |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | ethane;2-[(3E)-hexa-1,3,5-trien-3-yl]imidazo[2,1-b][1,3]benzothiazole-6-carboxamide;prop-1-ene |
| SMILES | C=C/C=C(\C=C)c1cn2c(n1)sc1cc(C(N)=O)ccc12.C=CC.CC.CC |
| InChI | InChI=1S/C16H13N3OS.C3H6.2C2H6/c1-3-5-10(4-2)12-9-19-13-7-6-11(15(17)20)8-14(13)21-16(19)18-12;1-3-2;2*1-2/h3-9H,1-2H2,(H2,17,20);3H,1H2,2H3;2*1-2H3/b10-5+;;; |
| InChIKey | YSRJNEAATZNBFD-RWWJYAHQSA-N |
| XLogP | 6.65 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|