About heptan-3-amine;yttrium
heptan-3-amine;yttrium (PubChem CID 164593353) has the molecular formula C7H16NY-
and a molecular weight of 203.12 g/mol. Its IUPAC name is heptan-3-amine;yttrium.
Molecular Properties
| Compound Name | heptan-3-amine;yttrium |
| PubChem CID | 164593353 |
| Molecular Formula | C7H16NY- |
| Molecular Weight | 203.12 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | heptan-3-amine;yttrium |
| SMILES | CC[CH-]CC(N)CC.[Y] |
| InChI | InChI=1S/C7H16N.Y/c1-3-5-6-7(8)4-2;/h5,7H,3-4,6,8H2,1-2H3;/q-1; |
| InChIKey | WPDDYHHWVRDDJA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.12 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze heptan-3-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-3-amine;yttrium?
The IUPAC name of heptan-3-amine;yttrium (CID 164593353) is heptan-3-amine;yttrium.
What is the SMILES notation for heptan-3-amine;yttrium?
The canonical SMILES for heptan-3-amine;yttrium is CC[CH-]CC(N)CC.[Y].
What is the InChIKey of heptan-3-amine;yttrium?
The InChIKey is WPDDYHHWVRDDJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N.Y/c1-3-5-6-7(8)4-2;/h5,7H,3-4,6,8H2,1-2H3;/q-1;.
What are the key properties of heptan-3-amine;yttrium?
heptan-3-amine;yttrium has a molecular weight of 203.12 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-3-amine;yttrium is sourced from PubChem (CID 164593353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).