C7H6NS3Y- — CID 164595003
3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-ide-4,6-dithione;yttrium (PubChem CID 164595003) has the molecular formula C7H6NS3Y- and a molecular weight of 289.24 g/mol. Its IUPAC name is 3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-ide-4,6-dithione;yttrium.
| Compound Name | 3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-ide-4,6-dithione;yttrium |
|---|---|
| PubChem CID | 164595003 |
| Molecular Formula | C7H6NS3Y- |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.87 |
| IUPAC Name | 3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-ide-4,6-dithione;yttrium |
| SMILES | S=C1C=C2SCCC2C(=S)[N-]1.[Y] |
| InChI | InChI=1S/C7H7NS3.Y/c9-6-3-5-4(1-2-11-5)7(10)8-6;/h3-4H,1-2H2,(H,8,9,10);/p-1 |
| InChIKey | LVKAJHIZDGSSDC-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|