C12H11F3N4O — CID 164600288
3-methyl-3-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide (PubChem CID 164600288) has the molecular formula C12H11F3N4O and a molecular weight of 284.24 g/mol. Its IUPAC name is 3-methyl-3-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide.
| Compound Name | 3-methyl-3-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 164600288 |
| Molecular Formula | C12H11F3N4O |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-methyl-3-(trifluoromethyl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxamide |
| SMILES | CC1(C(F)(F)F)CC(C(N)=O)c2cnc3ccnn3c21 |
| InChI | InChI=1S/C12H11F3N4O/c1-11(12(13,14)15)4-6(10(16)20)7-5-17-8-2-3-18-19(8)9(7)11/h2-3,5-6H,4H2,1H3,(H2,16,20) |
| InChIKey | CGVVOYMOYGAKTK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |