C15H16Cl2N8O — CID 164608914
1-(2,6-dichloro-4-pyridinyl)-3-[[4-(dimethylamino)-7-methylpyrrolo[2,3-d]pyrimidin-2-yl]amino]urea (PubChem CID 164608914) has the molecular formula C15H16Cl2N8O and a molecular weight of 395.25 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[4-(dimethylamino)-7-methylpyrrolo[2,3-d]pyrimidin-2-yl]amino]urea.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[4-(dimethylamino)-7-methylpyrrolo[2,3-d]pyrimidin-2-yl]amino]urea |
|---|---|
| PubChem CID | 164608914 |
| Molecular Formula | C15H16Cl2N8O |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[4-(dimethylamino)-7-methylpyrrolo[2,3-d]pyrimidin-2-yl]amino]urea |
| SMILES | CN(C)c1nc(NNC(=O)Nc2cc(Cl)nc(Cl)c2)nc2c1ccn2C |
| InChI | InChI=1S/C15H16Cl2N8O/c1-24(2)12-9-4-5-25(3)13(9)21-14(20-12)22-23-15(26)18-8-6-10(16)19-11(17)7-8/h4-7H,1-3H3,(H,20,21,22)(H2,18,19,23,26) |
| InChIKey | WYEQXQKRQDNQHZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|