C25H24BrNO5 — CID 164609937
[(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-bromoquinoline-6-carboxylate (PubChem CID 164609937) has the molecular formula C25H24BrNO5 and a molecular weight of 498.37 g/mol. Its IUPAC name is [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-bromoquinoline-6-carboxylate.
| Compound Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-bromoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 164609937 |
| Molecular Formula | C25H24BrNO5 |
| Molecular Weight | 498.37 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | [(1S,2S,4R,7E,11S)-4-methyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-8-yl]methyl 3-bromoquinoline-6-carboxylate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1CC/C(COC(=O)c1ccc3ncc(Br)cc3c1)=C\CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C25H24BrNO5/c1-14-19-7-5-15(4-3-9-25(2)22(32-25)21(19)31-23(14)28)13-30-24(29)16-6-8-20-17(10-16)11-18(26)12-27-20/h4,6,8,10-12,19,21-22H,1,3,5,7,9,13H2,2H3/b15-4+/t19-,21-,22-,25+/m0/s1 |
| InChIKey | FAEYMXHHJLMBIR-ZQLQCADUSA-N |
| XLogP | 4.91 |
| TPSA | 78.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|