C28H31NO7 — CID 164610867
N-hydroxy-2-[4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]phenyl]-2-methylpropanamide (PubChem CID 164610867) has the molecular formula C28H31NO7 and a molecular weight of 493.56 g/mol. Its IUPAC name is N-hydroxy-2-[4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]phenyl]-2-methylpropanamide.
| Compound Name | N-hydroxy-2-[4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 164610867 |
| Molecular Formula | C28H31NO7 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-hydroxy-2-[4-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]phenyl]-2-methylpropanamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1Oc1ccc(C(C)(C)C(=O)NO)cc1 |
| InChI | InChI=1S/C28H31NO7/c1-28(2,27(30)29-31)20-10-12-21(13-11-20)36-23-15-18(9-14-22(23)32-3)7-8-19-16-24(33-4)26(35-6)25(17-19)34-5/h7-17,31H,1-6H3,(H,29,30)/b8-7- |
| InChIKey | RMOXWUHSTCCOQU-FPLPWBNLSA-N |
| XLogP | 5.47 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|