C19H14F5NO2S — CID 164612215
2-fluoro-4-[3-fluoro-4-[(3-isothiocyanatocyclobutyl)oxymethyl]phenyl]-1-(trifluoromethoxy)benzene (PubChem CID 164612215) has the molecular formula C19H14F5NO2S and a molecular weight of 415.38 g/mol. Its IUPAC name is 2-fluoro-4-[3-fluoro-4-[(3-isothiocyanatocyclobutyl)oxymethyl]phenyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[3-fluoro-4-[(3-isothiocyanatocyclobutyl)oxymethyl]phenyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 164612215 |
| Molecular Formula | C19H14F5NO2S |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 2-fluoro-4-[3-fluoro-4-[(3-isothiocyanatocyclobutyl)oxymethyl]phenyl]-1-(trifluoromethoxy)benzene |
| SMILES | Fc1cc(-c2ccc(OC(F)(F)F)c(F)c2)ccc1COC1CC(N=C=S)C1 |
| InChI | InChI=1S/C19H14F5NO2S/c20-16-5-11(12-3-4-18(17(21)6-12)27-19(22,23)24)1-2-13(16)9-26-15-7-14(8-15)25-10-28/h1-6,14-15H,7-9H2 |
| InChIKey | ROKVPWHHBYTRKM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|