C24H34ClN7O — CID 164612845
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(6-chloropurin-9-yl)dodecanamide (PubChem CID 164612845) has the molecular formula C24H34ClN7O and a molecular weight of 472.04 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(6-chloropurin-9-yl)dodecanamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(6-chloropurin-9-yl)dodecanamide |
|---|---|
| PubChem CID | 164612845 |
| Molecular Formula | C24H34ClN7O |
| Molecular Weight | 472.04 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(6-chloropurin-9-yl)dodecanamide |
| SMILES | C#CCCC1(CCNC(=O)CC(CCCCCCCCC)n2cnc3c(Cl)ncnc32)N=N1 |
| InChI | InChI=1S/C24H34ClN7O/c1-3-5-7-8-9-10-11-12-19(32-18-29-21-22(25)27-17-28-23(21)32)16-20(33)26-15-14-24(30-31-24)13-6-4-2/h2,17-19H,3,5-16H2,1H3,(H,26,33) |
| InChIKey | JCDFJRPDZRXMHF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.04 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|