C37H38Cl2O9S2 — CID 164621393
[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 5-[2-(2,4-dichlorophenyl)-1,3-dithian-4-yl]pentanoate (PubChem CID 164621393) has the molecular formula C37H38Cl2O9S2 and a molecular weight of 761.74 g/mol. Its IUPAC name is [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 5-[2-(2,4-dichlorophenyl)-1,3-dithian-4-yl]pentanoate.
| Compound Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 5-[2-(2,4-dichlorophenyl)-1,3-dithian-4-yl]pentanoate |
|---|---|
| PubChem CID | 164621393 |
| Molecular Formula | C37H38Cl2O9S2 |
| Molecular Weight | 761.74 g/mol |
| Exact Mass | 760.13 |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 5-[2-(2,4-dichlorophenyl)-1,3-dithian-4-yl]pentanoate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)CCCCC3CCSC(c5ccc(Cl)cc5Cl)S3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C37H38Cl2O9S2/c1-42-29-12-19(13-30(43-2)35(29)44-3)32-23-15-27-28(47-18-46-27)16-24(23)34(25-17-45-36(41)33(25)32)48-31(40)7-5-4-6-21-10-11-49-37(50-21)22-9-8-20(38)14-26(22)39/h8-9,12-16,21,25,32-34,37H,4-7,10-11,17-18H2,1-3H3/t21?,25-,32+,33-,34-,37?/m0/s1 |
| InChIKey | BNQVQIKXJLECFD-MQKHJFMISA-N |
| XLogP | 8.76 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.74 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|