C8H11FN4S — CID 164647254
[5-fluoro-6-methyl-2-(thietan-3-yl)pyrimidin-4-yl]hydrazine (PubChem CID 164647254) has the molecular formula C8H11FN4S and a molecular weight of 214.27 g/mol. Its IUPAC name is [5-fluoro-6-methyl-2-(thietan-3-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [5-fluoro-6-methyl-2-(thietan-3-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 164647254 |
| Molecular Formula | C8H11FN4S |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | [5-fluoro-6-methyl-2-(thietan-3-yl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C2CSC2)nc(NN)c1F |
| InChI | InChI=1S/C8H11FN4S/c1-4-6(9)8(13-10)12-7(11-4)5-2-14-3-5/h5H,2-3,10H2,1H3,(H,11,12,13) |
| InChIKey | JPOCZHMEYPNEGV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|