C9H14N2OS2 — CID 164648391
N-(ethylsulfonimidoyl)-2-methylsulfanylaniline (PubChem CID 164648391) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N-(ethylsulfonimidoyl)-2-methylsulfanylaniline.
| Compound Name | N-(ethylsulfonimidoyl)-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 164648391 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | N-(ethylsulfonimidoyl)-2-methylsulfanylaniline |
| SMILES | [H]N=S(=O)(CC)Nc1ccccc1SC |
| InChI | InChI=1S/C9H14N2OS2/c1-3-14(10,12)11-8-6-4-5-7-9(8)13-2/h4-7H,3H2,1-2H3,(H2,10,11,12) |
| InChIKey | XEMZRJUOZAHGOH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |