C8H8F2IN3O — CID 164651912
4-[(3,3-difluorocyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 164651912) has the molecular formula C8H8F2IN3O and a molecular weight of 327.07 g/mol. Its IUPAC name is 4-[(3,3-difluorocyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(3,3-difluorocyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 164651912 |
| Molecular Formula | C8H8F2IN3O |
| Molecular Weight | 327.07 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 4-[(3,3-difluorocyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2CC(F)(F)C2)c1I |
| InChI | InChI=1S/C8H8F2IN3O/c9-8(10)1-4(2-8)14-6-5(11)7(15)13-3-12-6/h3-4H,1-2H2,(H2,12,13,14,15) |
| InChIKey | DFGYGGYTHJJYIA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|