C19H20Cl2F2NO2P — CID 164665838
3-(3,4-dichlorophenyl)-1-[diethylamino(phenyl)phosphoryl]-1,1-difluoropropan-2-one (PubChem CID 164665838) has the molecular formula C19H20Cl2F2NO2P and a molecular weight of 434.25 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[diethylamino(phenyl)phosphoryl]-1,1-difluoropropan-2-one.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[diethylamino(phenyl)phosphoryl]-1,1-difluoropropan-2-one |
|---|---|
| PubChem CID | 164665838 |
| Molecular Formula | C19H20Cl2F2NO2P |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[diethylamino(phenyl)phosphoryl]-1,1-difluoropropan-2-one |
| SMILES | CCN(CC)P(=O)(c1ccccc1)C(F)(F)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2F2NO2P/c1-3-24(4-2)27(26,15-8-6-5-7-9-15)19(22,23)18(25)13-14-10-11-16(20)17(21)12-14/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | PCYQCZNSWRQFPX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|