About 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran
7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran (PubChem CID 164667271) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran.
Analyze 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran?
The IUPAC name of 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran (CID 164667271) is 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran.
What is the SMILES notation for 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran?
The canonical SMILES for 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran is CC1OCC2=Cc3ccoc3CC21.
What is the InChIKey of 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran?
The InChIKey is WICHVRDXZKYJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-7-10-5-11-8(2-3-12-11)4-9(10)6-13-7/h2-4,7,10H,5-6H2,1H3.
What are the key properties of 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran?
7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran has a molecular weight of 176.22 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,7,7a,8-tetrahydrofuro[3,4-f][1]benzofuran is sourced from PubChem (CID 164667271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).