C33H60O5SSi2 — CID 164669997
[(6R,8aS)-6-ethylsulfanyl-2-phenyl-7-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tri(propan-2-yl)silane (PubChem CID 164669997) has the molecular formula C33H60O5SSi2 and a molecular weight of 625.08 g/mol. Its IUPAC name is [(6R,8aS)-6-ethylsulfanyl-2-phenyl-7-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(6R,8aS)-6-ethylsulfanyl-2-phenyl-7-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 164669997 |
| Molecular Formula | C33H60O5SSi2 |
| Molecular Weight | 625.08 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | [(6R,8aS)-6-ethylsulfanyl-2-phenyl-7-tri(propan-2-yl)silyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CCS[C@H]1OC2COC(c3ccccc3)O[C@@H]2C(O[Si](C(C)C)(C(C)C)C(C)C)C1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H60O5SSi2/c1-14-39-33-31(38-41(24(8)9,25(10)11)26(12)13)30(37-40(21(2)3,22(4)5)23(6)7)29-28(35-33)20-34-32(36-29)27-18-16-15-17-19-27/h15-19,21-26,28-33H,14,20H2,1-13H3/t28?,29-,30?,31?,32?,33+/m0/s1 |
| InChIKey | OCMSICYLHFWRJK-DGHDBZOVSA-N |
| XLogP | 9.70 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.08 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|