C44H50N3O4+ — CID 164673955
[(S)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 164673955) has the molecular formula C44H50N3O4+ and a molecular weight of 684.90 g/mol. Its IUPAC name is [(S)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(S)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 164673955 |
| Molecular Formula | C44H50N3O4+ |
| Molecular Weight | 684.90 g/mol |
| Exact Mass | 684.38 |
| IUPAC Name | [(S)-[1-(anthracen-9-ylmethyl)-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C=CC1C[N+]2(Cc3c4ccccc4cc4ccccc34)CCC1CC2[C@@H](OC(=O)[C@H](NC(=O)OC(C)(C)C)C(C)C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C44H49N3O4/c1-7-29-26-47(27-37-33-16-10-8-14-31(33)24-32-15-9-11-17-34(32)37)23-21-30(29)25-39(47)41(36-20-22-45-38-19-13-12-18-35(36)38)50-42(48)40(28(2)3)46-43(49)51-44(4,5)6/h7-20,22,24,28-30,39-41H,1,21,23,25-27H2,2-6H3/p+1/t29?,30?,39?,40-,41+,47?/m1/s1 |
| InChIKey | LFSDLYSQBFKLIT-UJHMHIPPSA-O |
| XLogP | 9.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.90 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|