C18H21NO4 — CID 164680676
dimethyl 2-ethenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate (PubChem CID 164680676) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is dimethyl 2-ethenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate.
| Compound Name | dimethyl 2-ethenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 164680676 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | dimethyl 2-ethenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene-3,3-dicarboxylate |
| SMILES | C=CC1N2CCCc3cccc(c32)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C18H21NO4/c1-4-14-18(16(20)22-2,17(21)23-3)11-13-8-5-7-12-9-6-10-19(14)15(12)13/h4-5,7-8,14H,1,6,9-11H2,2-3H3 |
| InChIKey | OUXOEEUMICWZIX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|