C21H22N2O2 — CID 10088254
methyl (2Z)-2-phenyl-2-[(8-prop-2-enyl-3,4-dihydro-2H-quinolin-1-yl)imino]acetate (PubChem CID 10088254) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl (2Z)-2-phenyl-2-[(8-prop-2-enyl-3,4-dihydro-2H-quinolin-1-yl)imino]acetate.
| Compound Name | methyl (2Z)-2-phenyl-2-[(8-prop-2-enyl-3,4-dihydro-2H-quinolin-1-yl)imino]acetate |
|---|---|
| PubChem CID | 10088254 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | methyl (2Z)-2-phenyl-2-[(8-prop-2-enyl-3,4-dihydro-2H-quinolin-1-yl)imino]acetate |
| SMILES | C=CCc1cccc2c1N(/N=C(\C(=O)OC)c1ccccc1)CCC2 |
| InChI | InChI=1S/C21H22N2O2/c1-3-9-17-12-7-13-18-14-8-15-23(20(17)18)22-19(21(24)25-2)16-10-5-4-6-11-16/h3-7,10-13H,1,8-9,14-15H2,2H3/b22-19- |
| InChIKey | ABCRZOQSMIAMNQ-QOCHGBHMSA-N |
| XLogP | 3.74 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|