About 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene
2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (PubChem CID 14090452) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
Analyze 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
The IUPAC name of 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene (CID 14090452) is 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene.
What is the SMILES notation for 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
The canonical SMILES for 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene is CC1Cc2cccc3c2N1CCC3.
What is the InChIKey of 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
The InChIKey is FTPUGMLGDALLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-9-8-11-5-2-4-10-6-3-7-13(9)12(10)11/h2,4-5,9H,3,6-8H2,1H3.
What are the key properties of 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene?
2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene has a molecular weight of 173.26 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-triene is sourced from PubChem (CID 14090452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).