C11H17N — CID 164680704
3-[(E)-prop-1-enyl]-3a,4,5,6,7,7a-hexahydro-1H-indole (PubChem CID 164680704) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 3-[(E)-prop-1-enyl]-3a,4,5,6,7,7a-hexahydro-1H-indole.
| Compound Name | 3-[(E)-prop-1-enyl]-3a,4,5,6,7,7a-hexahydro-1H-indole |
|---|---|
| PubChem CID | 164680704 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 3-[(E)-prop-1-enyl]-3a,4,5,6,7,7a-hexahydro-1H-indole |
| SMILES | C/C=C/C1=CNC2CCCCC12 |
| InChI | InChI=1S/C11H17N/c1-2-5-9-8-12-11-7-4-3-6-10(9)11/h2,5,8,10-12H,3-4,6-7H2,1H3/b5-2+ |
| InChIKey | CGVYTHSYJXJAHD-GORDUTHDSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |