C13H18FN — CID 170053364
2-fluoro-4,7-dimethyl-3-propyl-3a,7a-dihydro-1H-indole (PubChem CID 170053364) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-fluoro-4,7-dimethyl-3-propyl-3a,7a-dihydro-1H-indole.
| Compound Name | 2-fluoro-4,7-dimethyl-3-propyl-3a,7a-dihydro-1H-indole |
|---|---|
| PubChem CID | 170053364 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-fluoro-4,7-dimethyl-3-propyl-3a,7a-dihydro-1H-indole |
| SMILES | CCCC1=C(F)NC2C(C)=CC=C(C)C12 |
| InChI | InChI=1S/C13H18FN/c1-4-5-10-11-8(2)6-7-9(3)12(11)15-13(10)14/h6-7,11-12,15H,4-5H2,1-3H3 |
| InChIKey | WRJNPAHHXBLNGB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|