C20H23N — CID 164682377
4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine] (PubChem CID 164682377) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine].
| Compound Name | 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine] |
|---|---|
| PubChem CID | 164682377 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4'-phenylspiro[2,4-dihydro-1H-naphthalene-3,2'-piperidine] |
| SMILES | c1ccc(C2CCNC3(CCc4ccccc4C3)C2)cc1 |
| InChI | InChI=1S/C20H23N/c1-2-6-16(7-3-1)19-11-13-21-20(15-19)12-10-17-8-4-5-9-18(17)14-20/h1-9,19,21H,10-15H2 |
| InChIKey | OOPARWPCUFRRDX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |