C9H10Cl3NO — CID 164724189
N-[(2R)-1-(2,4,6-trichlorophenyl)propan-2-yl]hydroxylamine (PubChem CID 164724189) has the molecular formula C9H10Cl3NO and a molecular weight of 254.54 g/mol. Its IUPAC name is N-[(2R)-1-(2,4,6-trichlorophenyl)propan-2-yl]hydroxylamine.
| Compound Name | N-[(2R)-1-(2,4,6-trichlorophenyl)propan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 164724189 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | N-[(2R)-1-(2,4,6-trichlorophenyl)propan-2-yl]hydroxylamine |
| SMILES | C[C@H](Cc1c(Cl)cc(Cl)cc1Cl)NO |
| InChI | InChI=1S/C9H10Cl3NO/c1-5(13-14)2-7-8(11)3-6(10)4-9(7)12/h3-5,13-14H,2H2,1H3/t5-/m1/s1 |
| InChIKey | VSUSEOFAQFRBAL-RXMQYKEDSA-N |
| XLogP | 3.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|