C15H22N6O6 — CID 164728426
2-acetyloxyethyl 1-[2,2-bis(hydroxymethyl)-3-(4-methyltriazol-1-yl)propyl]triazole-4-carboxylate (PubChem CID 164728426) has the molecular formula C15H22N6O6 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-acetyloxyethyl 1-[2,2-bis(hydroxymethyl)-3-(4-methyltriazol-1-yl)propyl]triazole-4-carboxylate.
| Compound Name | 2-acetyloxyethyl 1-[2,2-bis(hydroxymethyl)-3-(4-methyltriazol-1-yl)propyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 164728426 |
| Molecular Formula | C15H22N6O6 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-acetyloxyethyl 1-[2,2-bis(hydroxymethyl)-3-(4-methyltriazol-1-yl)propyl]triazole-4-carboxylate |
| SMILES | CC(=O)OCCOC(=O)c1cn(CC(CO)(CO)Cn2cc(C)nn2)nn1 |
| InChI | InChI=1S/C15H22N6O6/c1-11-5-20(18-16-11)7-15(9-22,10-23)8-21-6-13(17-19-21)14(25)27-4-3-26-12(2)24/h5-6,22-23H,3-4,7-10H2,1-2H3 |
| InChIKey | KRHUNGUQVWJOAU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|