C8H9ClN2O — CID 164740595
5-chloro-7-methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine (PubChem CID 164740595) has the molecular formula C8H9ClN2O and a molecular weight of 184.63 g/mol. Its IUPAC name is 5-chloro-7-methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine.
| Compound Name | 5-chloro-7-methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 164740595 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 5-chloro-7-methyl-2,3-dihydrofuro[2,3-c]pyridin-3-amine |
| SMILES | Cc1nc(Cl)cc2c1OCC2N |
| InChI | InChI=1S/C8H9ClN2O/c1-4-8-5(2-7(9)11-4)6(10)3-12-8/h2,6H,3,10H2,1H3 |
| InChIKey | IAAYOSPEQQYIQG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|